Products 923728-13-6
CAS 923728-13-6 appears in our catalog under these names: 3-[5-(2,4-Dichlorophenyl)-1,3-oxazol-2-yl]propanoic acid, 95%, 3-(5-(2,4-Dichlorophenyl)-1,3-oxazol-2-yl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]propanoic acid (CAS 923728-13-6) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]propanoic acid. InChIKey: ZQEJOLXAIUSMHU-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO3 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]propanoic acid |
| InChIKey | ZQEJOLXAIUSMHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CN=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)