CAS 138509-79-2 appears in our catalog under these names: 3,4-Dichloro-1-(2-ethoxyphenyl)-1h-pyrrole-2,5-dione, 95%, 3,4-Dichloro-1-(2-ethoxyphenyl)-1H-pyrrole-2,5-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3,4-dichloro-1-(2-ethoxyphenyl)pyrrole-2,5-dione (CAS 138509-79-2) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: 3,4-dichloro-1-(2-ethoxyphenyl)pyrrole-2,5-dione. InChIKey: DSUWYIVXPBNPAQ-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO3 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | 3,4-dichloro-1-(2-ethoxyphenyl)pyrrole-2,5-dione |
| InChIKey | DSUWYIVXPBNPAQ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1N2C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)