CAS 730950-02-4 appears in our catalog under these names: (5,7-Dichloro-2-methyl-quinolin-8-yloxy)-acetic acid, 95%, 2-((5,7-Dichloro-2-methylquinolin-8-yl)oxy)acetic acid, 95%, 2-((5,7-Dichloro-2-methylquinolin-8-yl)oxy)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g, 0,5g.
2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetic acid (CAS 730950-02-4) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetic acid. InChIKey: UBPPSOBNDLDLMY-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO3 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetic acid |
| InChIKey | UBPPSOBNDLDLMY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2OCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)