CAS 4402-83-9 is the registry number for Methyl 3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 4402-83-9) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: YPCASVCAZYPZOI-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO3 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | YPCASVCAZYPZOI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)