CAS 861210-31-3 is the registry number for Methyl 2-([(1e)-2-cyano-2-(2,4-dichlorophenyl)eth-1-en-1-yl]oxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-[(E)-2-cyano-2-(2,4-dichlorophenyl)ethenoxy]acetate (CAS 861210-31-3) is a chemical compound with the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. IUPAC name: methyl 2-[(E)-2-cyano-2-(2,4-dichlorophenyl)ethenoxy]acetate. InChIKey: VBLPCAPIPZVREX-VURMDHGXSA-N.
| Molecular formula | C12H9Cl2NO3 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | methyl 2-[(E)-2-cyano-2-(2,4-dichlorophenyl)ethenoxy]acetate |
| InChIKey | VBLPCAPIPZVREX-VURMDHGXSA-N |
| SMILES | COC(=O)CO/C=C(/C#N)\C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)