CAS 1188263-50-4 is the registry number for N-(4-Hydroxyphenyl)-5-methyl-2-1H-pyridone-d4. Offered by: TRC. Available pack sizes: 10mg, 1mg.
5-methyl-1-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)pyridin-2-one (CAS 1188263-50-4) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 5-methyl-1-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)pyridin-2-one. InChIKey: NETTXQJYJRFTFS-LNFUJOGGSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 5-methyl-1-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)pyridin-2-one |
| InChIKey | NETTXQJYJRFTFS-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N2C=C(C=CC2=O)C)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)