Products 1228274-40-5

CAS 1228274-40-5 is the registry number for 4’-Hydroxy Pirfenidone-d3. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(4-hydroxyphenyl)-5-(trideuteriomethyl)pyridin-2-one (CAS 1228274-40-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 204.24 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-5-(trideuteriomethyl)pyridin-2-one. InChIKey: NETTXQJYJRFTFS-FIBGUPNXSA-N.

Identity
Molecular formulaC12H11NO2
Molecular weight204.24 g/mol
IUPAC name1-(4-hydroxyphenyl)-5-(trideuteriomethyl)pyridin-2-one
InChIKeyNETTXQJYJRFTFS-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C1=CN(C(=O)C=C1)C2=CC=C(C=C2)O

Computed by PubChem (NCBI)