CAS 1228274-40-5 is the registry number for 4’-Hydroxy Pirfenidone-d3. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-(4-hydroxyphenyl)-5-(trideuteriomethyl)pyridin-2-one (CAS 1228274-40-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 204.24 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-5-(trideuteriomethyl)pyridin-2-one. InChIKey: NETTXQJYJRFTFS-FIBGUPNXSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)-5-(trideuteriomethyl)pyridin-2-one |
| InChIKey | NETTXQJYJRFTFS-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CN(C(=O)C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)