Products 154428-10-1
CAS 154428-10-1 appears in our catalog under these names: Docetaxel Impurity 55, Docetaxel Impurity 45. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(3R,4S)-2-oxo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-3-yl] acetate (CAS 154428-10-1) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: [(3R,4S)-2-oxo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-3-yl] acetate. InChIKey: QCUYZEUTMVWGFD-DOPJRALCSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | [(3R,4S)-2-oxo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-3-yl] acetate |
| InChIKey | QCUYZEUTMVWGFD-DOPJRALCSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N2[C@H]([C@H](C2=O)OC(=O)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)