Products 1189861-06-0
CAS 1189861-06-0 is the registry number for N-Propionyl Mesalazine-d5. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-hydroxy-5-(2,2,3,3,3-pentadeuteriopropanoylamino)benzoic acid (CAS 1189861-06-0) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 214.23 g/mol. IUPAC name: 2-hydroxy-5-(2,2,3,3,3-pentadeuteriopropanoylamino)benzoic acid. InChIKey: WQIMCNDDLFCXFG-ZBJDZAJPSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | 2-hydroxy-5-(2,2,3,3,3-pentadeuteriopropanoylamino)benzoic acid |
| InChIKey | WQIMCNDDLFCXFG-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(=O)NC1=CC(=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)