CAS 93968-80-0 appears in our catalog under these names: N-Propionyl Mesalazine (N-Propionyl Mesalamine), N-Propionyl Mesalazine, Mesalazine impurity 10. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 1g, Get quote.
2-hydroxy-5-(propanoylamino)benzoic acid (CAS 93968-80-0) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2-hydroxy-5-(propanoylamino)benzoic acid. InChIKey: WQIMCNDDLFCXFG-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2-hydroxy-5-(propanoylamino)benzoic acid |
| InChIKey | WQIMCNDDLFCXFG-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=CC(=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)