CAS 1330265-97-8 appears in our catalog under these names: N-Propionyl Mesalazine-d3 (N-Propionyl Mesalamine-d3), N-Propionyl Mesalazine-d3. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg, 10 mg.
2,4,5-trideuterio-6-hydroxy-3-(propanoylamino)benzoic acid (CAS 1330265-97-8) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 212.22 g/mol. IUPAC name: 2,4,5-trideuterio-6-hydroxy-3-(propanoylamino)benzoic acid. InChIKey: WQIMCNDDLFCXFG-QGZYMEECSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 2,4,5-trideuterio-6-hydroxy-3-(propanoylamino)benzoic acid |
| InChIKey | WQIMCNDDLFCXFG-QGZYMEECSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)CC)[2H])C(=O)O)O)[2H] |
Computed by PubChem (NCBI)