Products 1189938-30-4
CAS 1189938-30-4 appears in our catalog under these names: Baclofen-d4, (±)-Baclofen-d4 (4-chlorophenyl-d4), 99 atom % D, min 98% Chemical Purity, (±)–Baclofen–d4, Baclofen-d4, 99.98%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 1 mg.
4-amino-3-(4-chloro-2,3,5,6-tetradeuteriophenyl)butanoic acid (CAS 1189938-30-4) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 217.68 g/mol. IUPAC name: 4-amino-3-(4-chloro-2,3,5,6-tetradeuteriophenyl)butanoic acid. InChIKey: KPYSYYIEGFHWSV-RHQRLBAQSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 217.68 g/mol |
| IUPAC name | 4-amino-3-(4-chloro-2,3,5,6-tetradeuteriophenyl)butanoic acid |
| InChIKey | KPYSYYIEGFHWSV-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(CC(=O)O)CN)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)