Products 70155-52-1
CAS 70155-52-1 appears in our catalog under these names: Baclofen-d4-1, Baclofen-d4 (Major). Offered by: MedChemExpress, TRC. Available pack sizes: 10 mg, 1 mg, 10mg, 1mg.
4-amino-3-(4-chlorophenyl)-2,2,4,4-tetradeuteriobutanoic acid (CAS 70155-52-1) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 217.68 g/mol. IUPAC name: 4-amino-3-(4-chlorophenyl)-2,2,4,4-tetradeuteriobutanoic acid. InChIKey: KPYSYYIEGFHWSV-NZLXMSDQSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 217.68 g/mol |
| IUPAC name | 4-amino-3-(4-chlorophenyl)-2,2,4,4-tetradeuteriobutanoic acid |
| InChIKey | KPYSYYIEGFHWSV-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C(C1=CC=C(C=C1)Cl)C([2H])([2H])N)C(=O)O |
Computed by PubChem (NCBI)