CAS 119-81-3 appears in our catalog under these names: 4–Acetamido–3–Nitroanisole, N-(4-Methoxy-2-nitrophenyl)acetamide, 98%, 4'-Methoxy-2'-nitroacetanilide, Rabeprazole Impurity 21, 2'-Nitro-p-acetanisidide. Offered by: GLPBio, Combi-blocks, Chemat Brand, TRC, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 5g, 1g, on request, 250mg, 500mg, 50g, 100mg.
N-(4-methoxy-2-nitrophenyl)acetamide (CAS 119-81-3) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: N-(4-methoxy-2-nitrophenyl)acetamide. InChIKey: QGEGALJODPBPGR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | N-(4-methoxy-2-nitrophenyl)acetamide |
| InChIKey | QGEGALJODPBPGR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)