Products 1391052-34-8
CAS 1391052-34-8 is the registry number for 2'-Nitro-p-acetanisidide-15N. Offered by: TRC. Available pack sizes: 100mg, 10mg.
N-[4-methoxy-2-[oxido(oxo)(15N)(15N)azaniumyl]phenyl]acetamide (CAS 1391052-34-8) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 211.18 g/mol. IUPAC name: N-[4-methoxy-2-[oxido(oxo)(15N)(15N)azaniumyl]phenyl]acetamide. InChIKey: QGEGALJODPBPGR-KHWBWMQUSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | N-[4-methoxy-2-[oxido(oxo)(15N)(15N)azaniumyl]phenyl]acetamide |
| InChIKey | QGEGALJODPBPGR-KHWBWMQUSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)OC)[15N+](=O)[O-] |
Computed by PubChem (NCBI)