Products 1190002-59-5
CAS 1190002-59-5 is the registry number for Ethyl 5-amino-1-(quinoxalin-2-yl)-1h-pyrazole-4-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 5-amino-1-quinoxalin-2-ylpyrazole-4-carboxylate (CAS 1190002-59-5) is a chemical compound with the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. IUPAC name: ethyl 5-amino-1-quinoxalin-2-ylpyrazole-4-carboxylate. InChIKey: PLIBOMRNIZZNPD-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O2 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | ethyl 5-amino-1-quinoxalin-2-ylpyrazole-4-carboxylate |
| InChIKey | PLIBOMRNIZZNPD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=NC3=CC=CC=C3N=C2)N |
Computed by PubChem (NCBI)