CAS 164520-05-2 is the registry number for Hsp90-IN-43. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-ethyl-6-methyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (CAS 164520-05-2) is a chemical compound with the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. IUPAC name: 1-ethyl-6-methyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione. InChIKey: HJXOIRIPJDWFBS-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O2 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 1-ethyl-6-methyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| InChIKey | HJXOIRIPJDWFBS-UHFFFAOYSA-N |
| SMILES | CCN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)