CAS 898447-01-3 is the registry number for 9-(3,4-Dimethylphenyl)-8,9-dihydro-8-oxo-7H-purine-6-carboxamide. Offered by: TRC. Available pack sizes: 250mg.
9-(3,4-dimethylphenyl)-8-oxo-7H-purine-6-carboxamide (CAS 898447-01-3) is a chemical compound with the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. IUPAC name: 9-(3,4-dimethylphenyl)-8-oxo-7H-purine-6-carboxamide. InChIKey: ZSXPGKUIGNMCQI-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O2 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 9-(3,4-dimethylphenyl)-8-oxo-7H-purine-6-carboxamide |
| InChIKey | ZSXPGKUIGNMCQI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C3=NC=NC(=C3NC2=O)C(=O)N)C |
Computed by PubChem (NCBI)