CAS 932497-74-0 is the registry number for 8,9-Dihydro-2-methyl-9-(4-methylphenyl)-8-oxo-7H-purine-6-carboxamide. Offered by: TRC. Available pack sizes: 1g.
2-methyl-9-(4-methylphenyl)-8-oxo-7H-purine-6-carboxamide (CAS 932497-74-0) is a chemical compound with the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. IUPAC name: 2-methyl-9-(4-methylphenyl)-8-oxo-7H-purine-6-carboxamide. InChIKey: PTNHSWQISAPVOU-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O2 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 2-methyl-9-(4-methylphenyl)-8-oxo-7H-purine-6-carboxamide |
| InChIKey | PTNHSWQISAPVOU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C3=NC(=NC(=C3NC2=O)C(=O)N)C |
Computed by PubChem (NCBI)