CAS 1365963-44-5 is the registry number for 3-[(2,3-Dimethyl-2h-pyrazolo[4,3-d]pyrimidin-7-yl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[(2,3-dimethylpyrazolo[4,3-d]pyrimidin-7-yl)amino]benzoic acid (CAS 1365963-44-5) is a chemical compound with the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. IUPAC name: 3-[(2,3-dimethylpyrazolo[4,3-d]pyrimidin-7-yl)amino]benzoic acid. InChIKey: NHQLPICXTCBHFP-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O2 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 3-[(2,3-dimethylpyrazolo[4,3-d]pyrimidin-7-yl)amino]benzoic acid |
| InChIKey | NHQLPICXTCBHFP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN1C)C(=NC=N2)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)