Products 145855-66-9
CAS 145855-66-9 is the registry number for (E)-4,4'-(Triaz-1-ene-1,3-diyl)dibenzamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
4-[2-(4-carbamoylphenyl)iminohydrazinyl]benzamide (CAS 145855-66-9) is a chemical compound with the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. IUPAC name: 4-[2-(4-carbamoylphenyl)iminohydrazinyl]benzamide. InChIKey: YQVOXEASACJXLJ-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O2 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 4-[2-(4-carbamoylphenyl)iminohydrazinyl]benzamide |
| InChIKey | YQVOXEASACJXLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)NN=NC2=CC=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)