CAS 68420-26-8 is the registry number for 1-(4-Nitrophenyl)-3-methyl-5-phenylformazan, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
N'-anilino-N-(4-nitrophenyl)iminoethanimidamide (CAS 68420-26-8) is a chemical compound with the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. IUPAC name: N'-anilino-N-(4-nitrophenyl)iminoethanimidamide. InChIKey: FHIGZTOTTOEVNT-DNTUAUKYSA-N.
| Molecular formula | C14H13N5O2 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | N'-anilino-N-(4-nitrophenyl)iminoethanimidamide |
| InChIKey | FHIGZTOTTOEVNT-DNTUAUKYSA-N |
| SMILES | C/C(=N\NC1=CC=CC=C1)/N=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)