Products 1190311-44-4
CAS 1190311-44-4 appears in our catalog under these names: 6-(Trifluoromethyl)-1H-pyrrolo[3，2-b]pyridine, 97%, 97%, 6-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine (CAS 1190311-44-4) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine. InChIKey: SMLPVLYYZMPXBV-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | SMLPVLYYZMPXBV-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1N=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)