Products 1190316-97-2
CAS 1190316-97-2 appears in our catalog under these names: 2-Methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid, 97%, 97%, 2-Methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
2-methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid (CAS 1190316-97-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid. InChIKey: GQFMEZOUSANEOT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid |
| InChIKey | GQFMEZOUSANEOT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)