Products 1191240-79-5
CAS 1191240-79-5 is the registry number for 6-Fluoro-5-methylindoline-2,3-dione, 95+%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-fluoro-5-methyl-1H-indole-2,3-dione (CAS 1191240-79-5) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 4-fluoro-5-methyl-1H-indole-2,3-dione. InChIKey: QKPYRSCPOOBXEJ-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-fluoro-5-methyl-1H-indole-2,3-dione |
| InChIKey | QKPYRSCPOOBXEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=O)C2=O)F |
Computed by PubChem (NCBI)