Products 1191414-21-7

CAS 1191414-21-7 is the registry number for Ethyl 4-(aminomethyl)cyclohexanecarboxylate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 25g.

Structural formula: {0} (CAS {1})

Ethyl 4-(aminomethyl)cyclohexane-1-carboxylate;hydrochloride (CAS 1191414-21-7) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: ethyl 4-(aminomethyl)cyclohexane-1-carboxylate;hydrochloride. InChIKey: ZGOGVHCRASZRFV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC nameethyl 4-(aminomethyl)cyclohexane-1-carboxylate;hydrochloride
InChIKeyZGOGVHCRASZRFV-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCC(CC1)CN.Cl

Computed by PubChem (NCBI)