CAS 67808-77-9 appears in our catalog under these names: (E)-3-Bromo-4-hydroxycinnamic Acid, >95% (HPLC), (E)-3-(3-Bromo-4-hydroxyphenyl)acrylic acid, 98%. Offered by: TRC, AmBeed. Available pack sizes: 2,5g, 250mg, 500mg, 1g, 100mg.
(E)-3-(3-bromo-4-hydroxyphenyl)prop-2-enoic acid (CAS 67808-77-9) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: (E)-3-(3-bromo-4-hydroxyphenyl)prop-2-enoic acid. InChIKey: HOZXBZABAJSGDX-DUXPYHPUSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | (E)-3-(3-bromo-4-hydroxyphenyl)prop-2-enoic acid |
| InChIKey | HOZXBZABAJSGDX-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)Br)O |
Computed by PubChem (NCBI)