Products 119540-53-3
CAS 119540-53-3 is the registry number for Adenosine-d1-1, 99.5%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 10 mg, 5 mg.
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-deuterio-5-(hydroxymethyl)oxolane-3,4-diol (CAS 119540-53-3) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 268.25 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-deuterio-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: OIRDTQYFTABQOQ-OWMYDFRGSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 268.25 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-deuterio-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | OIRDTQYFTABQOQ-OWMYDFRGSA-N |
| SMILES | [2H][C@@]1([C@@H]([C@@H]([C@H](O1)CO)O)O)N2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)