CAS 1196049-17-8 appears in our catalog under these names: Methyl 4-((1r)-1-amino-2-hydroxyethyl)benzoate hydrochloride, 95%, (R)-Methyl 4-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 97%, (R)–Methyl 4–(1–amino–2–hydroxyethyl)benzoate hydrochloride, Methyl 4-((1R)-1-amino-2-hydroxyethyl)benzoateHCl, (R)-Methyl 4-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
Methyl 4-[(1R)-1-amino-2-hydroxyethyl]benzoate;hydrochloride (CAS 1196049-17-8) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 4-[(1R)-1-amino-2-hydroxyethyl]benzoate;hydrochloride. InChIKey: OBDORQAVVCZMAL-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 4-[(1R)-1-amino-2-hydroxyethyl]benzoate;hydrochloride |
| InChIKey | OBDORQAVVCZMAL-FVGYRXGTSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)