Products 2055840-04-3

CAS 2055840-04-3 is the registry number for Methyl 4-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(1-amino-2-hydroxyethyl)benzoate;hydrochloride (CAS 2055840-04-3) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 4-(1-amino-2-hydroxyethyl)benzoate;hydrochloride. InChIKey: OBDORQAVVCZMAL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO3
Molecular weight231.67 g/mol
IUPAC namemethyl 4-(1-amino-2-hydroxyethyl)benzoate;hydrochloride
InChIKeyOBDORQAVVCZMAL-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)C(CO)N.Cl

Computed by PubChem (NCBI)