CAS 1336889-03-2 appears in our catalog under these names: Methyl 4-((1s)-1-amino-2-hydroxyethyl)benzoate hydrochloride, 95%, (S)–Methyl 4–(1–amino–2–hydroxyethyl)benzoate hydrochloride, Methyl 4-((1S)-1-amino-2-hydroxyethyl)benzoate hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
Methyl 4-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride (CAS 1336889-03-2) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 4-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride. InChIKey: OBDORQAVVCZMAL-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 4-[(1S)-1-amino-2-hydroxyethyl]benzoate;hydrochloride |
| InChIKey | OBDORQAVVCZMAL-SBSPUUFOSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)