Products 2173090-63-4
CAS 2173090-63-4 is the registry number for Ethyl 6-(aminomethyl)nicotinate dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 6-(aminomethyl)pyridine-3-carboxylate;dihydrochloride (CAS 2173090-63-4) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: ethyl 6-(aminomethyl)pyridine-3-carboxylate;dihydrochloride. InChIKey: QOOLFQRBEQKDMG-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | ethyl 6-(aminomethyl)pyridine-3-carboxylate;dihydrochloride |
| InChIKey | QOOLFQRBEQKDMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)