Products 1197234-09-5
CAS 1197234-09-5 appears in our catalog under these names: 2-(3,4-Difluorophenyl)pyrrolidine hydrochloride, 98%, 2-(3,4-Difluorophenyl)pyrrolidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(3,4-difluorophenyl)pyrrolidine;hydrochloride (CAS 1197234-09-5) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 2-(3,4-difluorophenyl)pyrrolidine;hydrochloride. InChIKey: PXMDJKBIGCGCEY-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | PXMDJKBIGCGCEY-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)