CAS 1198391-70-6 appears in our catalog under these names: Methyl 3-oxo-2,3-dihydro-1H-isoindole-1-carboxylate, 95%, Methyl 3-oxo-2,3-dihydro-1H-isoindole-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 3-oxo-1,2-dihydroisoindole-1-carboxylate (CAS 1198391-70-6) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 3-oxo-1,2-dihydroisoindole-1-carboxylate. InChIKey: FTFQEIGJZWIFPE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 3-oxo-1,2-dihydroisoindole-1-carboxylate |
| InChIKey | FTFQEIGJZWIFPE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2=CC=CC=C2C(=O)N1 |
Computed by PubChem (NCBI)