CAS 1199-04-8 is the registry number for 6-Bromo-3,4-dihydrobenzo(e)(1,3)oxazin-2-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-3,4-dihydro-1,3-benzoxazin-2-one (CAS 1199-04-8) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 6-bromo-3,4-dihydro-1,3-benzoxazin-2-one. InChIKey: GUBFXJAFQXKEIT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-1,3-benzoxazin-2-one |
| InChIKey | GUBFXJAFQXKEIT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)OC(=O)N1 |
Computed by PubChem (NCBI)