CAS 1199225-40-5 is the registry number for (S)-2-(3-Chloro-2,2-dimethyl-propionylamino)-3-methylbutanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2,2-dimethylpropanamide (CAS 1199225-40-5) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 3-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2,2-dimethylpropanamide. InChIKey: NBXJRNNARUAEFQ-MRVPVSSYSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 3-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2,2-dimethylpropanamide |
| InChIKey | NBXJRNNARUAEFQ-MRVPVSSYSA-N |
| SMILES | CC(C)[C@@H](CO)NC(=O)C(C)(C)CCl |
Computed by PubChem (NCBI)