Products 1199782-74-5
CAS 1199782-74-5 appears in our catalog under these names: 7-Fluoro-5-methoxy-2,3-dihydro-1h-inden-1-one, 95%, 7-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one, 97%, 7-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one, 7-FLUORO-5-METHOXY-1-INDANONE, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g, 100mg.
7-fluoro-5-methoxy-2,3-dihydroinden-1-one (CAS 1199782-74-5) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 7-fluoro-5-methoxy-2,3-dihydroinden-1-one. InChIKey: FDNWTRIRARZLBG-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 7-fluoro-5-methoxy-2,3-dihydroinden-1-one |
| InChIKey | FDNWTRIRARZLBG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=O)CC2)C(=C1)F |
Computed by PubChem (NCBI)