CAS 1201-24-7 appears in our catalog under these names: 5-Methyl-1H-indazole-3-carboxylic acid, 98%, 98%, 5-Methyl-1H-indazole-3-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5-methyl-1H-indazole-3-carboxylic acid (CAS 1201-24-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-methyl-1H-indazole-3-carboxylic acid. InChIKey: QRTAIBBOZNHRMI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-methyl-1H-indazole-3-carboxylic acid |
| InChIKey | QRTAIBBOZNHRMI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NN=C2C(=O)O |
Computed by PubChem (NCBI)