Products 1201594-40-2
CAS 1201594-40-2 is the registry number for 3-Oxocyclohex-1-en-1-yl dimethylsulfamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
(3-oxocyclohexen-1-yl) N,N-dimethylsulfamate (CAS 1201594-40-2) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: (3-oxocyclohexen-1-yl) N,N-dimethylsulfamate. InChIKey: BSNFEPMLXLOKEB-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | (3-oxocyclohexen-1-yl) N,N-dimethylsulfamate |
| InChIKey | BSNFEPMLXLOKEB-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)OC1=CC(=O)CCC1 |
Computed by PubChem (NCBI)