CAS 1704326-61-3 is the registry number for (E)-3-((1,1-Dioxidotetrahydro-2H-thiopyran-4-yl)amino)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[(1,1-dioxothian-4-yl)amino]prop-2-enoic acid (CAS 1704326-61-3) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: (E)-3-[(1,1-dioxothian-4-yl)amino]prop-2-enoic acid. InChIKey: QMVREHJDMWODEU-DAFODLJHSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | (E)-3-[(1,1-dioxothian-4-yl)amino]prop-2-enoic acid |
| InChIKey | QMVREHJDMWODEU-DAFODLJHSA-N |
| SMILES | C1CS(=O)(=O)CCC1N/C=C/C(=O)O |
Computed by PubChem (NCBI)