Products 1822443-38-8
CAS 1822443-38-8 is the registry number for Hexahydro-2H-pyrrolo[1,2-b][1,2]thiazine-7-carboxylic acid 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-dioxo-3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-b]thiazine-7-carboxylic acid (CAS 1822443-38-8) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: 1,1-dioxo-3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-b]thiazine-7-carboxylic acid. InChIKey: MQHMHHJJIJWGRT-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 1,1-dioxo-3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-b]thiazine-7-carboxylic acid |
| InChIKey | MQHMHHJJIJWGRT-UHFFFAOYSA-N |
| SMILES | C1CC2CCC(N2S(=O)(=O)C1)C(=O)O |
Computed by PubChem (NCBI)