CAS 1690425-32-1 is the registry number for 9-anti-rel-(1R,5S)-3-Thia-7-azabicyclo[3.3.1]nonane-9-carboxylic acid 3,3-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-3,3-dioxo-3lambda6-thia-7-azabicyclo[3.3.1]nonane-9-carboxylic acid (CAS 1690425-32-1) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: (1S,5R)-3,3-dioxo-3lambda6-thia-7-azabicyclo[3.3.1]nonane-9-carboxylic acid. InChIKey: QSSQSJGYZDANQJ-MEKDEQNOSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | (1S,5R)-3,3-dioxo-3lambda6-thia-7-azabicyclo[3.3.1]nonane-9-carboxylic acid |
| InChIKey | QSSQSJGYZDANQJ-MEKDEQNOSA-N |
| SMILES | C1[C@@H]2CS(=O)(=O)C[C@@H](C2C(=O)O)CN1 |
Computed by PubChem (NCBI)