CAS 2126159-90-6 is the registry number for 5-Methoxy-3a-methyl-1,1-dioxo-5,6-dihydro-4H-pyrrolo(1,2-b)(1,2)thiazol-3-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methoxy-3a-methyl-1,1-dioxo-5,6-dihydro-4H-pyrrolo[1,2-b][1,2]thiazol-3-one (CAS 2126159-90-6) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: 5-methoxy-3a-methyl-1,1-dioxo-5,6-dihydro-4H-pyrrolo[1,2-b][1,2]thiazol-3-one. InChIKey: AXAUFMYEVWYHTC-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 5-methoxy-3a-methyl-1,1-dioxo-5,6-dihydro-4H-pyrrolo[1,2-b][1,2]thiazol-3-one |
| InChIKey | AXAUFMYEVWYHTC-UHFFFAOYSA-N |
| SMILES | CC12CC(CN1S(=O)(=O)CC2=O)OC |
Computed by PubChem (NCBI)