CAS 1849769-97-6 is the registry number for Methyl 1-(1,1-dioxidothietan-3-yl)azetidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(1,1-dioxothietan-3-yl)azetidine-2-carboxylate (CAS 1849769-97-6) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: methyl 1-(1,1-dioxothietan-3-yl)azetidine-2-carboxylate. InChIKey: VBHJXZNXNXVQQW-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | methyl 1-(1,1-dioxothietan-3-yl)azetidine-2-carboxylate |
| InChIKey | VBHJXZNXNXVQQW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN1C2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)