Products 1995071-62-9
CAS 1995071-62-9 is the registry number for 4-(2-Hydroxypropan-2-yl)-5-methylfuran-2-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-hydroxypropan-2-yl)-5-methylfuran-2-sulfonamide (CAS 1995071-62-9) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: 4-(2-hydroxypropan-2-yl)-5-methylfuran-2-sulfonamide. InChIKey: YGBSUTINDSALSQ-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 4-(2-hydroxypropan-2-yl)-5-methylfuran-2-sulfonamide |
| InChIKey | YGBSUTINDSALSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)S(=O)(=O)N)C(C)(C)O |
Computed by PubChem (NCBI)