CAS 1201651-31-1 appears in our catalog under these names: Fmoc-L-Ser(Psi(Me,Me)Pro)-OH, Fmoc-Ser(Psi(Me,Me)Pro)-OH 98%, (S)-3-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2,2-dimethyloxazolidine-4-carboxylic acid, 98%, 98%. Offered by: Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 2g, 10g, 100g, 250mg.
(4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 1201651-31-1) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: RGGJQFWYGIRJKS-SFHVURJKSA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (4S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | RGGJQFWYGIRJKS-SFHVURJKSA-N |
| SMILES | CC1(N([C@@H](CO1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)