CAS 1202003-44-8 appears in our catalog under these names: (S)-2-Amino-6-((tert-butoxycarbonyl)amino)-2-methylhexanoic acid, 98%, 98%, (S)-2-Amino-6-((tert-butoxycarbonyl)amino)-2-methylhexanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1202003-44-8) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. IUPAC name: (2S)-2-amino-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: UTZMJBPKJZXALK-LBPRGKRZSA-N.
| Molecular formula | C12H24N2O4 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | (2S)-2-amino-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | UTZMJBPKJZXALK-LBPRGKRZSA-N |
| SMILES | C[C@](CCCCNC(=O)OC(C)(C)C)(C(=O)O)N |
Computed by PubChem (NCBI)