CAS 120258-61-9 appears in our catalog under these names: 2,5,6–TRICHLOROBENZOTHIAZOLE, 2,5,6-Trichlorobenzo[d]thiazole 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 10mg, 250mg, 50mg, 100mg.
2,5,6-trichloro-1,3-benzothiazole (CAS 120258-61-9) is a chemical compound with the molecular formula C7H2Cl3NS and a molecular weight of 238.5 g/mol. IUPAC name: 2,5,6-trichloro-1,3-benzothiazole. InChIKey: WNVSIKFDDOOWGR-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NS |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 2,5,6-trichloro-1,3-benzothiazole |
| InChIKey | WNVSIKFDDOOWGR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)SC(=N2)Cl |
Computed by PubChem (NCBI)