CAS 898747-75-6 appears in our catalog under these names: 2,5,7-Trichlorobenzothiazole, 95%, 2,5,7-Trichlorobenzo(d)thiazole, 95+%, 2,5,7–Trichlorobenzo(d)thiazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2,5,7-trichloro-1,3-benzothiazole (CAS 898747-75-6) is a chemical compound with the molecular formula C7H2Cl3NS and a molecular weight of 238.5 g/mol. IUPAC name: 2,5,7-trichloro-1,3-benzothiazole. InChIKey: KGRGQBHLGRICHB-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NS |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 2,5,7-trichloro-1,3-benzothiazole |
| InChIKey | KGRGQBHLGRICHB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(S2)Cl)Cl)Cl |
Computed by PubChem (NCBI)