CAS 23165-46-0 appears in our catalog under these names: 2,4,5-Trichlorophenyl isothiocyanate, 95%, 2,4,5-Trichlorophenyl isothiocyanate, 98%, 1,2,4-Trichloro-5-isothiocyanatobenzene, 99%(GC-MS),RG, 99%(GC-MS),RG. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
1,2,4-trichloro-5-isothiocyanatobenzene (CAS 23165-46-0) is a chemical compound with the molecular formula C7H2Cl3NS and a molecular weight of 238.5 g/mol. IUPAC name: 1,2,4-trichloro-5-isothiocyanatobenzene. InChIKey: PJLRSYLEFZNICX-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NS |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 1,2,4-trichloro-5-isothiocyanatobenzene |
| InChIKey | PJLRSYLEFZNICX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)N=C=S |
Computed by PubChem (NCBI)